1036756-15-6 | 6-Bromo-8-fluoroquinazolin-2(1H)-one

Packsize	Purity	Availability	Price	Discounted Price
250mg	97%	in stock	$376.00	$263.00
1g	97%	in stock	$886.00	$620.00

Description

• Catalog Number: AX05225
• Chemical Name: 6-Bromo-8-fluoroquinazolin-2(1H)-one
• CAS Number: 1036756-15-6
• Molecular Formula: C8H4BrFN2O
• Molecular Weight: 243.0326
• MDL Number: MFCD30475301
• SMILES: Brc1cc(F)c2c(c1)cnc(=O)[nH]2

Upstream Synthesis Route

6-Bromo-8-fluoroquinazolin-2(1H)-one is a valuable compound widely employed in chemical synthesis. With its unique structure and reactivity, this chemical plays a crucial role in various synthetic processes. One primary application of 6-Bromo-8-fluoroquinazolin-2(1H)-one is as a versatile building block in the synthesis of heterocyclic compounds. Its bromo and fluoro substituents provide sites for further functionalization, allowing for the creation of complex molecular structures. Additionally, the presence of the quinazolinone scaffold imparts specific properties to the resulting compounds, making them useful in pharmaceutical research and drug development. Furthermore, 6-Bromo-8-fluoroquinazolin-2(1H)-one can participate in various coupling reactions, such as Suzuki, Heck, or Sonogashira couplings, enabling the formation of carbon-carbon and carbon-heteroatom bonds. This versatility makes it a valuable tool for constructing organic molecules with specific chemical functionalities. Overall, the use of 6-Bromo-8-fluoroquinazolin-2(1H)-one in chemical synthesis offers chemists a powerful means to access diverse molecular architectures with potential applications in drug discovery, materials science, and other fields of research.