10380-08-2 | triphosphoric acid

Availability
Typically In Stock

Description

• Catalog Number: AE18796
• Chemical Name: triphosphoric acid
• CAS Number: 10380-08-2
• Molecular Formula: H5O10P3
• Molecular Weight: 257.9550
• MDL Number: MFCD12032087
• SMILES: OP(=O)(OP(=O)(O)O)OP(=O)(O)O

Upstream Synthesis Route

Triphosphoric acid, also known as triphosphoric acid or H5P3O10, is a crucial reagent in chemical synthesis due to its unique properties and versatility. Its main application lies in its ability to act as a powerful dehydrating agent, facilitating a wide range of reactions by removing water molecules from the reactants. This dehydration process is essential in various organic syntheses, particularly in esterification and amidation reactions where the removal of water is crucial for driving the equilibrium towards product formation. Triphosphoric acid's dehydrating power also makes it a valuable tool in the synthesis of diverse organic compounds, such as pharmaceuticals, polymers, and agrochemicals. Additionally, its acidic nature enables it to catalyze certain reactions, increasing reaction rates and overall yields. Overall, triphosphoric acid serves as a key component in the toolbox of synthetic chemists, enabling the efficient and tailored synthesis of complex molecules.