AY26451
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $215.00 | $150.00 | - + | |
250mg | 95% | in stock | $385.00 | $269.00 | - + | |
1g | 95% | in stock | $855.00 | $598.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AY26451 |
Chemical Name: | 5-Quinolinecarboxylic acid, 8-hydroxy-2-methyl- |
CAS Number: | 103853-87-8 |
Molecular Formula: | C11H9NO3 |
Molecular Weight: | 203.1941 |
MDL Number: | MFCD13190218 |
SMILES: | Cc1ccc2c(n1)c(O)ccc2C(=O)O |
5-Quinolinecarboxylic acid, 8-hydroxy-2-methyl- is a versatile chemical compound commonly used in chemical synthesis processes. Its unique structure and properties make it a valuable reagent in various reactions and transformations. This compound serves as a key building block in the synthesis of pharmaceutical intermediates, agrochemicals, and fine chemicals. Additionally, it is utilized in the preparation of heterocyclic compounds and coordination complexes in organic synthesis. Its presence in a reaction mixture can facilitate the formation of new chemical bonds and enable the creation of complex molecular structures. In summary, the application of 5-Quinolinecarboxylic acid, 8-hydroxy-2-methyl- plays a crucial role in expanding the possibilities of chemical synthesis and enhancing the efficiency of synthetic pathways.