AE09119
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
25mg | 97% | in stock | $130.00 | $91.00 | - + | |
100mg | 97% | in stock | $245.00 | $172.00 | - + | |
250mg | 97% | in stock | $249.00 | $175.00 | - + | |
1g | 97% | in stock | $556.00 | $390.00 | - + | |
5g | 97% | in stock | $1,535.00 | $1,074.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE09119 |
Chemical Name: | (S)-Amino-(2-methoxy-phenyl)-acetic acid |
CAS Number: | 103889-86-7 |
Molecular Formula: | C9H11NO3 |
Molecular Weight: | 181.1885 |
MDL Number: | MFCD06858445 |
SMILES: | COc1ccccc1[C@@H](C(=O)O)N |
Complexity: | 184 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 3 |
XLogP3: | -1.7 |
The (S)-2-Amino-2-(2-methoxyphenyl)acetic acid, also known as $name$, serves as a valuable building block in chemical synthesis. Its chiral nature, stemming from the (S)-configuration, lends itself well to asymmetric synthesis strategies. Due to its unique structure, this compound can be utilized in the creation of pharmaceutical intermediates, specifically in the development of chiral drugs. With its ability to participate in various reactions, $name$ plays a crucial role in the construction of bioactive molecules and complex organic compounds. Furthermore, its presence in the synthesis of peptide mimics and novel materials showcases its versatility in the realm of organic chemistry.