AI06191
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 95% | in stock | $18.00 | $12.00 | - + | |
25g | 95% | in stock | $42.00 | $29.00 | - + | |
100g | 95% | in stock | $119.00 | $83.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI06191 |
Chemical Name: | (Boc-Cys-OH)2 |
CAS Number: | 10389-65-8 |
Molecular Formula: | C16H28N2O8S2 |
Molecular Weight: | 440.5321 |
MDL Number: | MFCD00038250 |
SMILES: | OC(=O)[C@@H](NC(=O)OC(C)(C)C)CSSC[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
Complexity: | 522 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 2 |
Heavy Atom Count: | 28 |
Hydrogen Bond Acceptor Count: | 10 |
Hydrogen Bond Donor Count: | 4 |
Rotatable Bond Count: | 13 |
XLogP3: | 1.6 |
Boc-Cys-OH is a valuable tool in chemical synthesis due to its ability to protect the thiol group of cysteine during peptide synthesis. This compound, also known as N-tert-butoxycarbonyl-L-cysteine, is commonly used in the production of peptides and proteins where the reactive thiol group needs to be temporarily masked to prevent unwanted side reactions. By utilizing Boc-Cys-OH as a protecting group, chemists can control the reactivity of cysteine residues, allowing for selective modification of peptides and proteins without compromising their overall structure or function. Additionally, Boc-Cys-OH offers stability and compatibility with a variety of commonly used reagents and solvents, making it a versatile tool for the synthesis of complex molecules in both research and industrial settings.