logo
Home  > 9-Octadecenoic acid(9Z)-, copper salt (1:?)

AD79731

10402-16-1 | 9-Octadecenoic acid(9Z)-, copper salt (1:?)

Availability
Typically In Stock

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AD79731
Chemical Name: 9-Octadecenoic acid(9Z)-, copper salt (1:?)
CAS Number: 10402-16-1
Molecular Formula: C36H66CuO4
Molecular Weight: 626.4528
SMILES: CCCCCCCC/C=CCCCCCCCC(=O)[O-].CCCCCCCC/C=CCCCCCCCC(=O)[O-].[Cu+2]

 

Upstream Synthesis Route
  • Copper oleate, a complex chemical compound formed from copper and oleic acid, plays a pivotal role in various chemical synthesis processes. This versatile substance is commonly utilized as a catalyst in organic reactions, particularly in the production of pharmaceuticals, polymers, and fine chemicals. Its ability to facilitate reactions by lowering activation energy and improving reaction kinetics makes it an invaluable tool in the field of organic chemistry. Additionally, copper oleate is a crucial component in the formation of metal complexes, which are essential intermediates in the preparation of novel materials and coordination compounds. With its unique properties and reactivity, copper oleate serves as a fundamental building block in the realm of chemical synthesis, enabling the creation of diverse compounds with enhanced functionality and performance.
FEATURED PRODUCTS