AD79431
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $25.00 | $17.00 | - + | |
5g | 95% | in stock | $41.00 | $29.00 | - + | |
25g | 95% | in stock | $52.00 | $37.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD79431 |
Chemical Name: | Fmoc-d-glu(obzl)-oh |
CAS Number: | 104091-11-4 |
Molecular Formula: | C27H25NO6 |
Molecular Weight: | 459.4905 |
MDL Number: | MFCD00273449 |
SMILES: | O=C(CC[C@H](C(=O)O)NC(=O)OCC1c2ccccc2-c2c1cccc2)OCc1ccccc1 |
Complexity: | 683 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 34 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 11 |
XLogP3: | 4.4 |
Fmoc-D-Glu(OBZL)-OH, also known as Fmoc-protected glutamic acid with an OBZL linker, is a versatile building block commonly used in peptide synthesis. This compound plays a crucial role in solid-phase peptide synthesis (SPPS) due to its ability to selectively protect the carboxylic acid group of glutamic acid while allowing for further chemical manipulations.With the Fmoc group shielding the amino group and the OBZL linker protecting the carboxyl group of glutamic acid, Fmoc-D-Glu(OBZL)-OH provides chemists with a strategically masked functionality that can be selectively deprotected and activated as needed during the peptide assembly process. This controlled deprotection allows for efficient coupling reactions with other amino acids or peptide fragments, enabling the synthesis of complex peptides and peptide mimetics with high fidelity and purity.Moreover, the presence of the OBZL linker in Fmoc-D-Glu(OBZL)-OH offers compatibility with a variety of coupling agents and activation methods commonly employed in peptide chemistry. This broad compatibility makes this building block suitable for the synthesis of a wide range of peptides, including bioactive peptides, cyclic peptides, peptide conjugates, and peptidomimetics used in drug discovery and development, chemical biology research, and other fields requiring precise molecular design.In essence, Fmoc-D-Glu(OBZL)-OH is an essential tool in the chemist's arsenal for the construction of custom-designed peptides with specific structures and functions, making it a valuable component in the synthesis of diverse peptide-based compounds for various applications in the life sciences and beyond.