AX19992
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | in stock | $142.00 | $99.00 | - + | |
1g | 98% | in stock | $166.00 | $116.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AX19992 |
Chemical Name: | Imazapic |
CAS Number: | 104098-48-8 |
Molecular Formula: | C14H17N3O3 |
Molecular Weight: | 275.3031 |
MDL Number: | MFCD04307828 |
SMILES: | Cc1cnc(c(c1)C(=O)O)C1=NC(C(=O)N1)(C)C(C)C |
Complexity: | 461 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 20 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 3 |
Undefined Atom Stereocenter Count: | 1 |
XLogP3: | 1.6 |
Imazapic is widely utilized in chemical synthesis as a potent herbicide, specifically belonging to the imidazolinone family. Its chemical structure enables it to selectively target broadleaf weeds and grasses, making it a highly effective tool for weed control in agricultural settings. In organic synthesis, Imazapic is commonly employed for the preparation of various herbicidal formulations and can be utilized to create custom herbicide blends with specific target properties. Its ability to inhibit the growth of unwanted plant species while being relatively safe for desired crops makes Imazapic a valuable tool in modern agricultural practices. Additionally, its selective mode of action and environmentally friendly profile further enhance its appeal in chemical synthesis applications.
Acta crystallographica. Section E, Structure reports online 20120601
Ecotoxicology and environmental safety 20110301
Journal of environmental science and health. Part. B, Pesticides, food contaminants, and agricultural wastes 20091101
Journal of agricultural and food chemistry 20071128
Pest management science 20020901