AI06279
Availability | ||
---|---|---|
Typically In Stock |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI06279 |
Chemical Name: | Dichloro[bis(dicyclohexylphosphino)propane]palladium(ii) |
CAS Number: | 1041005-52-0 |
Molecular Formula: | C27H52Cl2P2Pd++ |
Molecular Weight: | 615.9753 |
MDL Number: | MFCD14155689 |
SMILES: | C(C[PH+](C1CCCCC1)C1CCCCC1)C[PH+](C1CCCCC1)C1CCCCC1.Cl[Pd]Cl |
The compound Dichloro[bis(dicyclohexylphosphino)propane]palladium(II) is widely utilized in chemical synthesis as a catalyst in various organic reactions. This palladium(II) complex acts as a versatile and efficient catalyst for numerous transformations, including cross-coupling reactions, C-H activation, and olefin functionalization. Its unique structure allows it to facilitate bond formation and modification in complex organic molecules, making it an indispensable tool in modern synthetic chemistry. This specific catalyst has been employed in the synthesis of pharmaceuticals, agrochemicals, and advanced materials due to its ability to promote selective and high-yielding transformations.