AD79358
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $300.00 | $210.00 | - + | |
5g | 95% | in stock | $1,199.00 | $839.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD79358 |
Chemical Name: | 3,5-Dichloro-4-(1,1,2,2-tetrafluoroethoxy)aniline |
CAS Number: | 104147-32-2 |
Molecular Formula: | C8H5Cl2F4NO |
Molecular Weight: | 278.031 |
MDL Number: | MFCD10000640 |
SMILES: | FC(C(Oc1c(Cl)cc(cc1Cl)N)(F)F)F |
Complexity: | 232 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
XLogP3: | 4.1 |
3,5-Dichloro-4-(1,1,2,2-tetrafluoroethoxy)aniline is a versatile compound widely used in chemical synthesis. This compound plays a crucial role in the development of various pharmaceuticals, agrochemicals, and materials. In chemical synthesis, it serves as a key building block for the creation of complex organic molecules with specific properties and functionalities. The presence of both chloro and tetrafluoroethoxy groups in its structure imparts unique reactivity and selectivity to reactions involving this compound. Its use in coupling reactions, nucleophilic substitutions, and transition metal-catalyzed processes enables the efficient and precise formation of new carbon-carbon and carbon-heteroatom bonds. By incorporating this compound in synthesis pathways, chemists can access a diverse array of structurally distinct compounds with tailored properties for a wide range of applications.
Acta crystallographica. Section E, Structure reports online 20100801