logo
Home  > 2,6-Dimethylquinoline-4-carboxylic acid

AD79335

104175-33-9 | 2,6-Dimethylquinoline-4-carboxylic acid

Packsize Purity Availability Price Discounted Price    Quantity
1g 95% in stock $106.00 $75.00 -   +
5g 95% in stock $159.00 $111.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AD79335
Chemical Name: 2,6-Dimethylquinoline-4-carboxylic acid
CAS Number: 104175-33-9
Molecular Formula: C12H11NO2
Molecular Weight: 201.2212
MDL Number: MFCD00487548
SMILES: Cc1ccc2c(c1)c(cc(n2)C)C(=O)O

 

Upstream Synthesis Route
  • 2,6-Dimethylquinoline-4-carboxylic acid is a versatile compound widely used in chemical synthesis due to its unique properties and reactivity. This aromatic carboxylic acid serves as a valuable building block in the preparation of various pharmaceuticals, agrochemicals, and specialty chemicals.One significant application of 2,6-Dimethylquinoline-4-carboxylic acid is its role as a key intermediate in the synthesis of pharmaceutical drugs. It can be utilized in the construction of complex molecules through diverse chemical reactions such as esterification, amidation, and cyclization. The presence of the quinoline ring in the structure imparts specific biological activities to the final products, making this compound crucial in drug discovery and development.Furthermore, 2,6-Dimethylquinoline-4-carboxylic acid finds use in the preparation of agrochemicals and plant growth regulators. By incorporating this compound into the synthesis of pesticides, herbicides, or fungicides, chemists can enhance the efficacy and selectivity of these agricultural products. The carboxylic acid group enables easy functionalization of the molecule, allowing for the introduction of additional features to optimize the desired bioactivity.In industrial chemistry, 2,6-Dimethylquinoline-4-carboxylic acid serves as a valuable precursor for the production of specialty chemicals used in various applications. Its ability to participate in diverse organic reactions enables the synthesis of custom-designed molecules with specific properties, making it a sought-after compound in the chemical industry.Overall, the versatile nature of 2,6-Dimethylquinoline-4-carboxylic acid makes it an indispensable tool for chemists engaged in the synthesis of advanced materials, pharmaceuticals, agrochemicals, and other specialty chemicals. Its structural features and reactivity offer a wide range of possibilities for creating novel compounds with tailored functionalities and applications.
FEATURED PRODUCTS