1042084-20-7 | 6-CrAsH-EDT2

Availability
Typically In Stock

Description

• Catalog Number: AE14502
• Chemical Name: 6-CrAsH-EDT2
• CAS Number: 1042084-20-7
• Molecular Formula: C25H18As2O7S4
• Molecular Weight: 708.5094
• SMILES: O=C1OC2(c3c1ccc(c3)C(=O)O)c1ccc(c(c1Oc1c2ccc(c1[As]1SCCS1)O)[As]1SCCS1)O

Upstream Synthesis Route

In chemical synthesis, 4',5'-Bis(1,3,2-dithiarsolan-2-yl)-3',6'-dihydroxy-3-oxospiro[isobenzofuran-1(3H),9'-[9H]xanthene]-6-carboxylic Acid serves as a versatile building block due to its unique molecular structure. This compound can be utilized as a key intermediate in the preparation of complex organic molecules, allowing for the introduction of specific functional groups and stereochemical elements in the desired positions. Its reactive moieties enable the formation of new carbon-carbon and carbon-heteroatom bonds, facilitating the synthesis of diverse chemical entities with potential pharmacological or materials science applications. Additionally, the presence of multiple reactive sites in the molecule offers opportunities for selective derivatization and further manipulation to tailor the properties of the final products.