logo
Home  > 6,7-Dimethoxy-3-(4-methoxy-6-methyl-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]isoquinolin-5-yl)-3h-isobenzofuran-1-one

AI06310

10421-76-8 | 6,7-Dimethoxy-3-(4-methoxy-6-methyl-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]isoquinolin-5-yl)-3h-isobenzofuran-1-one

Packsize Purity Availability Price Discounted Price    Quantity
1g 95% in stock $57.00 $40.00 -   +
5g 95% in stock $153.00 $107.00 -   +
10g 95% in stock $249.00 $175.00 -   +
25g 95% in stock $448.00 $314.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AI06310
Chemical Name: 6,7-Dimethoxy-3-(4-methoxy-6-methyl-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]isoquinolin-5-yl)-3h-isobenzofuran-1-one
CAS Number: 10421-76-8
Molecular Formula: C22H23NO7
Molecular Weight: 413.4205
MDL Number: MFCD00127721
SMILES: COc1ccc2c(c1OC)C(=O)OC2C1N(C)CCc2c1c(OC)c1c(c2)OCO1

 

Computed Properties
Complexity: 647  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 30  
Hydrogen Bond Acceptor Count: 8  
Rotatable Bond Count: 4  
Undefined Atom Stereocenter Count: 2  
XLogP3: 2.7  

 

 

Upstream Synthesis Route 
  • The compound 1(3H)-Isobenzofuranone, 6,7-dimethoxy-3-(5,6,7,8-tetrahydro-4-methoxy-6-methyl-1,3-dioxolo[4,5-g]isoquinolin-5-yl)-, is utilized in chemical synthesis as a key intermediate for the creation of pharmaceuticals, agrochemicals, and other fine chemicals. Its unique structure lends itself to being a versatile building block in the synthesis of complex molecules due to its ability to participate in various types of reactions, such as condensation, cyclization, and functional group transformations. This compound plays a crucial role in the development of novel compounds with potential biological activities and diverse applications in the field of medicinal chemistry and materials science.
Literature
FEATURED PRODUCTS