AE08448
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $33.00 | $23.00 | - + | |
5g | 95% | in stock | $117.00 | $82.00 | - + | |
10g | 95% | in stock | $154.00 | $108.00 | - + | |
25g | 95% | in stock | $306.00 | $214.00 | - + | |
100g | 95% | in stock | $858.00 | $600.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE08448 |
Chemical Name: | (4aR,4bS,6aS,7S,9aS,9bS,11aR)-4a,6a-Dimethyl-2-oxo-2,4a,4b,5,6,6a,7,8,9,9a,9b,10,11,11a-tetradecahydro-1H-indeno[5,4-f]quinoline-7-carboxylic acid |
CAS Number: | 104239-97-6 |
Molecular Formula: | C19H27NO3 |
Molecular Weight: | 317.4225799999999 |
MDL Number: | MFCD08063794 |
SMILES: | O=C1C=C[C@]2([C@H](N1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2C(=O)O)C)C |
Complexity: | 585 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 7 |
Heavy Atom Count: | 23 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 1 |
XLogP3: | 2.3 |
The 3-Oxo-4-aza-5α-androst-1-ene-17β-carboxylic Acid is a versatile compound that finds crucial application in chemical synthesis processes. Due to its unique structure and functional groups, this compound serves as a key building block in the creation of diverse pharmaceuticals, especially those targeted at hormone-related disorders. In synthetic chemistry, it acts as a valuable intermediate for the synthesis of various steroid-based compounds, enabling the production of specialized drugs with enhanced biological activity and pharmacological properties. Additionally, its reactivity and structural features make it a valuable tool in the design and development of novel chemical entities for medicinal and research purposes.