10425-71-5 | 3,5-DINITRO-4-HYDROXYPYRIDINE

Packsize	Purity	Availability	Price	Discounted Price
500mg	95%	2 weeks	$406.00	$284.00
1g	95%	2 weeks	$533.00	$373.00
5g	95%	2 weeks	$1,370.00	$959.00

Description

• Catalog Number: AE10737
• Chemical Name: 3,5-DINITRO-4-HYDROXYPYRIDINE
• CAS Number: 10425-71-5
• Molecular Formula: C5H3N3O5
• Molecular Weight: 185.0944
• MDL Number: MFCD00222297
• SMILES: Oc1c(cncc1[N+](=O)[O-])[N+](=O)[O-]

Upstream Synthesis Route

The compound 3,5-Dinitro-4-pyridinol, also known as DNPO, has a significant role in chemical synthesis as a versatile building block. Its unique structure and reactivity make it an essential intermediate in the production of various compounds across different industries.In chemical synthesis, 3,5-Dinitro-4-pyridinol is commonly used as a key starting material in the synthesis of agrochemicals, pharmaceuticals, and specialty chemicals. Its nitro and hydroxyl functional groups enable it to participate in a wide range of reactions, including nucleophilic substitution, reduction, and coupling reactions.One of the primary applications of 3,5-Dinitro-4-pyridinol is in the synthesis of pesticides and herbicides. By incorporating this compound into the molecular structure of agrochemicals, researchers can enhance their efficacy and specificity, leading to improved crop protection and increased agricultural productivity.Furthermore, 3,5-Dinitro-4-pyridinol plays a crucial role in pharmaceutical synthesis by serving as a building block for the development of drug candidates. Its ability to undergo diverse chemical transformations allows medicinal chemists to modify its structure to create novel compounds with potential therapeutic benefits.In the realm of specialty chemicals, 3,5-Dinitro-4-pyridinol finds applications in the synthesis of dyes, pigments, and other high-value products. Its versatility and compatibility with various synthetic methodologies make it a valuable asset in the production of custom chemicals for industrial use.Overall, 3,5-Dinitro-4-pyridinol serves as a foundational component in chemical synthesis, enabling the creation of complex molecules with specific properties and functionalities. Its importance extends across multiple sectors, making it a versatile and indispensable building block in the pursuit of innovative chemical solutions.