AE56860
Availability | ||
---|---|---|
Typically In Stock |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE56860 |
Chemical Name: | 7-mercaptoheptanoylthreonine phosphate |
CAS Number: | 104302-77-4 |
Molecular Formula: | C11H22NO7PS |
Molecular Weight: | 343.3336 |
SMILES: | CC(C(C(=O)O)NC(=O)CCCCCCS)OP(=O)(O)O |
Coenzyme B, also known as coenzyme A, plays a vital role in chemical synthesis as a key intermediate in various metabolic pathways. In organic chemistry, Coenzyme B serves as a critical cofactor in numerous enzymatic reactions, facilitating the transfer of acyl groups between different substrates. This essential molecule is involved in the metabolism of carbohydrates, lipids, and proteins, contributing to the production of energy and the synthesis of important biomolecules.In chemical synthesis, Coenzyme B is utilized as a versatile building block for the creation of complex organic compounds. Its thiol group allows for the formation of thioesters, which can undergo various chemical transformations, such as acyl transfers and nucleophilic substitutions. By serving as a carrier of acyl groups, Coenzyme B enables the efficient synthesis of diverse molecules with specific functionalities, making it a valuable tool in the preparation of pharmaceuticals, agrochemicals, and other fine chemicals.Moreover, the flexibility of Coenzyme B in accommodating different acyl moieties and reacting with various nucleophiles makes it a versatile reagent in organic synthesis. Its role as a coenzyme in numerous enzymatic reactions highlights its importance in catalyzing key steps in metabolic pathways and the biosynthesis of essential molecules. In summary, Coenzyme B's significance in chemical synthesis lies in its ability to serve as a multifunctional building block for creating complex organic molecules with specific chemical properties.