logo
Home  > Phenol, 4-(dimethylamino)-2,6-bis(1,1-dimethylethyl)-

AD49646

10437-44-2 | Phenol, 4-(dimethylamino)-2,6-bis(1,1-dimethylethyl)-

Availability
Typically In Stock

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AD49646
Chemical Name: Phenol, 4-(dimethylamino)-2,6-bis(1,1-dimethylethyl)-
CAS Number: 10437-44-2
Molecular Formula: C16H27NO
Molecular Weight: 249.3917
MDL Number: MFCD31689251
SMILES: CN(c1cc(c(c(c1)C(C)(C)C)O)C(C)(C)C)C

 

Upstream Synthesis Route
  • Phenol, 4-(dimethylamino)-2,6-bis(1,1-dimethylethyl)- is a versatile chemical compound widely used in chemical synthesis processes. Its unique molecular structure lends itself well to a variety of applications in organic chemistry. Specifically, this compound is valued for its role as a key intermediate in the synthesis of various pharmaceuticals, agrochemicals, and specialty chemicals. Its presence in the reaction mixture facilitates the formation of complex organic molecules through key functional group transformations. Additionally, the sterically hindered nature of this compound enhances selectivity in certain chemical reactions, leading to improved product yields and purity. Researchers and chemists rely on Phenol, 4-(dimethylamino)-2,6-bis(1,1-dimethylethyl)- for its ability to accelerate and control reactions, making it a valuable tool in the realm of chemical synthesis.
FEATURED PRODUCTS