AE16434
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
50mg | 95% | 1 week | $257.00 | $180.00 | - + | |
100mg | 95% | 1 week | $344.00 | $241.00 | - + | |
250mg | 95% | 1 week | $458.00 | $321.00 | - + | |
500mg | 95% | 1 week | $803.00 | $563.00 | - + | |
1g | 95% | 1 week | $1,043.00 | $730.00 | - + | |
2.5g | 95% | 1 week | $1,971.00 | $1,380.00 | - + | |
5g | 95% | 1 week | $2,877.00 | $2,014.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE16434 |
Chemical Name: | TOLUENE-4-SULFONIC ACID CYCLOBUTYL ESTER |
CAS Number: | 10437-85-1 |
Molecular Formula: | C11H14O3S |
Molecular Weight: | 226.2921 |
MDL Number: | MFCD03844436 |
SMILES: | Cc1ccc(cc1)S(=O)(=O)OC1CCC1 |
Cyclobutanol, 1-(4-methylbenzenesulfonate) is a versatile compound that finds extensive application in chemical synthesis processes. As a key reagent, it serves as a crucial building block in the creation of various organic molecules and pharmaceutical intermediates. This compound plays a fundamental role in the formation of complex structures with specific functional groups, facilitating the synthesis of new materials and compounds in the field of organic chemistry. With its unique properties and reactivity, Cyclobutanol, 1-(4-methylbenzenesulfonate) offers chemists a valuable tool for designing and developing innovative synthetic routes and strategies for the production of target molecules.