AB60055
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
500mg | 95% | in stock | $601.00 | $421.00 | - + | |
1g | 95% | in stock | $840.00 | $588.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB60055 |
Chemical Name: | 2,4,6-TRIMETHOXYPHENYLACETIC ACID |
CAS Number: | 104397-80-0 |
Molecular Formula: | C11H14O5 |
Molecular Weight: | 226.2259 |
MDL Number: | MFCD00016821 |
SMILES: | COc1cc(OC)cc(c1CC(=O)O)OC |
2,4,6-Trimethoxyphenylacetic acid is a versatile compound widely used in chemical synthesis as a key building block for the preparation of various organic molecules. Its unique structure provides it with a range of functional groups that allow for specific modifications and reactions in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals. This compound is commonly employed as a starting material in the production of complex organic compounds due to its ability to undergo various chemical transformations, such as esterification, alkylation, and oxidation. Its presence in the synthesis pathway of many important molecules highlights its significance in the field of organic chemistry and its crucial role in the development of innovative materials and compounds.