AD80672
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 1 | 2 weeks | $172.00 | $120.00 | - + | |
25g | 1 | 2 weeks | $374.00 | $262.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD80672 |
Chemical Name: | Tetrabutylammonium hydrogen monopersulfate |
CAS Number: | 104548-30-3 |
Molecular Formula: | C16H37NO8S2 |
Molecular Weight: | 435.59687999999977 |
MDL Number: | MFCD20503057 |
SMILES: | [O-]S(=O)(=O)OOS(=O)(=O)O.CCCC[N+](CCCC)(CCCC)CCCC |
Tetrabutylammonium persulfate triple salt is a versatile and powerful compound used in various chemical synthesis processes. Its unique properties make it a valuable tool for numerous applications in the field of chemistry.One of the key uses of tetrabutylammonium persulfate triple salt is as a radical initiator in polymerization reactions. When activated, this compound generates sulfate radicals that initiate the polymerization of monomers, leading to the formation of polymers with controlled molecular weights and structures. This makes it an essential component in the production of advanced polymers with tailored properties.Additionally, tetrabutylammonium persulfate triple salt is employed as an oxidizing agent in organic synthesis. It can facilitate the oxidation of various functional groups, enabling the conversion of starting materials into valuable intermediates or final products. Its high reactivity and selectivity make it particularly useful in the synthesis of complex organic molecules.Furthermore, this compound is utilized in electrochemical reactions, where it serves as a source of persulfate ions. These ions play a crucial role in driving electrochemical processes, such as electrodeposition and electrochemical polymerization. By harnessing the unique properties of tetrabutylammonium persulfate triple salt, chemists can achieve precise control over electrochemical transformations.Overall, tetrabutylammonium persulfate triple salt is a versatile and efficient reagent that finds widespread applications in chemical synthesis. Its ability to act as a radical initiator, oxidizing agent, and persulfate source makes it an indispensable tool for researchers and industrial chemists working in various fields of chemistry.