AE10919
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $53.00 | $37.00 | - + | |
1g | 95% | in stock | $74.00 | $52.00 | - + | |
5g | 95% | in stock | $219.00 | $153.00 | - + | |
10g | 95% | in stock | $403.00 | $282.00 | - + | |
25g | 95% | in stock | $869.00 | $608.00 | - + | |
100g | 95% | in stock | $2,578.00 | $1,805.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE10919 |
Chemical Name: | 5'-O-(4,4'-Dimethoxytrityl)-N4-benzoyl-5-methyl-2'-deoxycytidine |
CAS Number: | 104579-03-5 |
Molecular Formula: | C38H37N3O7 |
Molecular Weight: | 647.7163 |
MDL Number: | MFCD00057965 |
SMILES: | COc1ccc(cc1)C(c1ccc(cc1)OC)(c1ccccc1)OC[C@H]1O[C@H](C[C@@H]1O)n1cc(C)c(nc1=O)NC(=O)c1ccccc1 |
Complexity: | 1120 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 3 |
Heavy Atom Count: | 48 |
Hydrogen Bond Acceptor Count: | 7 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 11 |
XLogP3: | 5.6 |
The compound $name$ serves as a valuable tool in chemical synthesis due to its unique structure and reactivity. As an N-substituted benzamide derivative, $name$ plays a crucial role in various synthetic pathways by acting as a versatile building block. Its presence enables the formation of intricate molecular structures through selective bonding interactions and functional group transformations. By strategically incorporating N-(1-((2R,4S,5R)-5-((Bis(4-methoxyphenyl)(phenyl)methoxy)methyl)-4-hydroxytetrahydrofuran-2-yl)-5-methyl-2-oxo-1,2-dihydropyrimidin-4-yl)benzamide into synthetic schemes, chemists can access novel molecules with tailored properties and applications across diverse research fields.
Nucleosides, nucleotides & nucleic acids 20060101