logo
Home  > 4,4'-Methylenedibenzonitrile

AE08327

10466-37-2 | 4,4'-Methylenedibenzonitrile

Packsize Purity Availability Price Discounted Price    Quantity
250mg 95% in stock $23.00 $16.00 -   +
1g 95% in stock $49.00 $34.00 -   +
5g 95% in stock $133.00 $93.00 -   +
10g 95% in stock $235.00 $164.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AE08327
Chemical Name: 4,4'-Methylenedibenzonitrile
CAS Number: 10466-37-2
Molecular Formula: C15H10N2
Molecular Weight: 218.2533
MDL Number: MFCD09032983
SMILES: N#Cc1ccc(cc1)Cc1ccc(cc1)C#N

 

Upstream Synthesis Route 
  • 4,4'-(1-Methylene) bis-Benzonitrile is a versatile chemical compound used in various chemical synthesis processes. Its unique structure enables it to serve as a valuable building block in the creation of diverse organic compounds. In chemical synthesis, this compound plays a crucial role as a crosslinking agent, allowing for the formation of complex molecular structures with enhanced stability and functionality. Moreover, 4,4'-(1-Methylene) bis-Benzonitrile can participate in reactions such as nucleophilic substitution and condensation, contributing to the efficient production of specialized compounds. Its application extends to the synthesis of pharmaceuticals, agrochemicals, and advanced materials, highlighting its significance in modern chemical research and development.
FEATURED PRODUCTS