AI06410
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
500mg | 98% | in stock | $48.00 | $34.00 | - + | |
1g | 98% | in stock | $70.00 | $49.00 | - + | |
5g | 98% | in stock | $279.00 | $196.00 | - + | |
10g | 98% | in stock | $510.00 | $357.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI06410 |
Chemical Name: | Methyl 3-bromo-2-nitrobenzoate |
CAS Number: | 104670-71-5 |
Molecular Formula: | C8H6BrNO4 |
Molecular Weight: | 260.04154 |
MDL Number: | MFCD14697993 |
SMILES: | [O-][N+](=O)c1c(cccc1Br)C(=O)OC |
Methyl 3-bromo-2-nitrobenzoate is a versatile compound widely used in chemical synthesis as a key building block for the preparation of various organic molecules. This compound is known for its reactivity and ability to participate in a range of different reactions, making it a valuable tool for synthetic chemists.One common application of Methyl 3-bromo-2-nitrobenzoate is in the synthesis of pharmaceuticals and agrochemicals. By incorporating this compound into complex molecular structures, chemists can access new compounds with potentially valuable biological activities. Additionally, Methyl 3-bromo-2-nitrobenzoate can be utilized in the preparation of specialty chemicals and fine chemicals, where its unique properties can enable the creation of innovative products.In addition to its role in pharmaceutical and agrochemical synthesis, Methyl 3-bromo-2-nitrobenzoate is also employed in academic research and industrial applications. Its versatility and reactivity make it a valuable precursor for the synthesis of a wide range of compounds, contributing to advancements in synthetic chemistry and the development of new materials.Overall, Methyl 3-bromo-2-nitrobenzoate is a valuable tool in chemical synthesis, enabling the creation of diverse organic molecules with applications in various industries and fields of study.