logo
Home  > GSK2141795

AE11235

1047634-65-0 | GSK2141795

Packsize Purity Availability Price Discounted Price    Quantity
1mg 98% in stock $42.00 $29.00 -   +
5mg 98% in stock $116.00 $81.00 -   +
10mg 98% in stock $173.00 $121.00 -   +
25mg 98% in stock $288.00 $201.00 -   +
50mg 98% in stock $445.00 $311.00 -   +
100mg 98% in stock $739.00 $517.00 -   +
250mg 98% in stock $1,223.00 $856.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AE11235
Chemical Name: GSK2141795
CAS Number: 1047634-65-0
Molecular Formula: C18H16Cl2F2N4O2
Molecular Weight: 429.24804639999985
MDL Number: MFCD28144686
SMILES: NCC(NC(=O)c1oc(c(c1)c1c(Cl)cnn1C)Cl)Cc1ccc(c(c1)F)F

 

Upstream Synthesis Route
  • GSK2141795, a potent and selective inhibitor of the protein kinase PDK1, plays a crucial role in chemical synthesis processes. Its ability to specifically target PDK1 makes it a valuable tool in various synthetic pathways, particularly in the development of novel compounds and pharmaceuticals. By inhibiting PDK1, GSK2141795 can modulate various signaling cascades that are involved in cellular processes, offering a precise way to manipulate specific chemical reactions. This targeted approach enables chemists to control key steps in the synthesis of complex molecules, facilitating the creation of unique chemical structures with desired properties. Additionally, the use of GSK2141795 in chemical synthesis allows researchers to explore new avenues in drug discovery and development, offering opportunities to study disease pathways and identify potential therapeutic targets.
FEATURED PRODUCTS