AE57236
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 85% | 2 weeks | $211.00 | $148.00 | - + | |
5mg | 85% | 2 weeks | $547.00 | $383.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE57236 |
Chemical Name: | 7-METHYLGUANOSINE 5'-TRIPHOSPHATE SODIUM SALT |
CAS Number: | 104809-18-9 |
Molecular Formula: | C11H18N5Na2O14P3 |
Molecular Weight: | 583.1865 |
MDL Number: | MFCD00063376 |
SMILES: | O[C@@H]1[C@@H](COP(=O)(OP(=O)(OP(=O)(O)O)O)[O-])O[C@H]([C@@H]1O)n1c[n+](c2c1[nH]c(N)nc2=O)C.[Na].[Na] |
7-Methylguanosine 5'-triphosphate sodium salt, commonly referred to as 7-Me-GTP-Na, is a vital biochemical reagent extensively used in chemical synthesis processes. This specific compound serves as a crucial substrate in various enzymatic reactions involved in RNA metabolism and modification. The introduction of the methyl group at the 7-position of the guanosine base enhances the molecule's stability and selectivity, making it an ideal building block for synthesizing modified RNA molecules with increased biological activity and structural integrity. In chemical synthesis applications, 7-Methylguanosine 5'-triphosphate sodium salt acts as a valuable precursor for the production of modified RNA sequences used in molecular biology research, pharmaceutical drug development, and the creation of novel therapeutics targeting specific RNA-related diseases. Its inherent chemical properties and functional role in RNA modification processes make it a versatile tool for researchers and chemists seeking to engineer tailored RNA molecules with enhanced functionalities and diverse applications.