AE17672
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 1 week | $114.00 | $80.00 | - + | ||
5mg | 1 week | $204.00 | $143.00 | - + | ||
10mg | 1 week | $279.00 | $195.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE17672 |
Chemical Name: | DEAMIDO NAD SODIUM SALT |
CAS Number: | 104809-30-5 |
Molecular Formula: | C21H25N6NaO15P2 |
Molecular Weight: | 686.3917 |
MDL Number: | MFCD00082430 |
SMILES: | O[C@@H]1[C@H](O)[C@H](O[C@H]1[n+]1cccc(c1)C(=O)O)COP(=O)(OP(=O)(OC[C@H]1O[C@H]([C@@H]([C@@H]1O)O)n1cnc2c1ncnc2N)[O-])[O-].[Na+] |
Adenosine 5′-(trihydrogen diphosphate), P′→5′-ester with 3-carboxy-1-β-D-ribofuranosylpyridinium inner salt, monosodium salt is a highly versatile compound widely used in chemical synthesis. This compound is particularly valuable in organic chemistry for its ability to serve as a key building block in the synthesis of nucleotide analogs and other bioactive molecules. Its unique chemical structure and reactivity make it an essential tool for researchers and chemists working in the field of drug discovery, molecular biology, and medicinal chemistry. This compound enables the efficient and precise modification of nucleotide sequences, allowing for the creation of novel compounds with potential therapeutic applications. Its utility extends to the development of new pharmaceuticals, as well as the study of biochemical pathways and interactions. In chemical synthesis, Adenosine 5′-(trihydrogen diphosphate), P′→5′-ester with 3-carboxy-1-β-D-ribofuranosylpyridinium inner salt, monosodium salt serves as a versatile and indispensable reagent for the construction of complex molecules with tailored properties and functions.