AY22194
Availability | ||
---|---|---|
Typically In Stock |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AY22194 |
Chemical Name: | (R)-6,7-Dimethoxy-2-methyl-1-(3,4,5-trimethoxybenzyl)-1,2,3,4-tetrahydroisoquinoline (2R,3R)-2,3-bis(benzoyloxy)succinate |
CAS Number: | 104832-01-1 |
Molecular Formula: | C39H41NO13 |
Molecular Weight: | 731.7417 |
MDL Number: | MFCD29904971 |
SMILES: | OC(=O)[C@@H]([C@H](C(=O)O)OC(=O)c1ccccc1)OC(=O)c1ccccc1.COc1cc2CCN[C@@H](c2cc1OC)Cc1cc(OC)c(c(c1)OC)OC |
The compound Butanedioic acid, 2,3-bis(benzoyloxy)-, (2R,3R)-, compd. with (1R)-1,2,3,4-tetrahydro-6,7-dimethoxy-2-methyl-1-[(3,4,5-trimethoxyphenyl)methyl]isoquinoline (1:1) is utilized in chemical synthesis as a key component for creating various complex organic molecules. This compound plays a crucial role in the formation of intricate structures through controlled reactions and transformations. Its ability to participate in specific chemical reactions leads to the development of novel compounds with unique properties and applications in pharmaceuticals, materials science, and other fields of research.