logo
Home  > Chemistry  > Heterocyclic Building Blocks  > Piperidines  > Methyl 1-boc-4-fluoropiperidine-4-carboxylate

AE28836

1048994-21-3 | Methyl 1-boc-4-fluoropiperidine-4-carboxylate

Packsize Purity Availability Price Discounted Price    Quantity
250mg 95% in stock $89.00 $62.00 -   +
1g 95% in stock $116.00 $81.00 -   +
5g 95% in stock $463.00 $324.00 -   +
10g 95% in stock $774.00 $542.00 -   +
25g 95% in stock $1,535.00 $1,074.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AE28836
Chemical Name: Methyl 1-boc-4-fluoropiperidine-4-carboxylate
CAS Number: 1048994-21-3
Molecular Formula: C12H20FNO4
Molecular Weight: 261.2899032
MDL Number: MFCD18074440
SMILES: COC(=O)C1(F)CCN(CC1)C(=O)OC(C)(C)C

 

Computed Properties
Complexity: 330  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 18  
Hydrogen Bond Acceptor Count: 5  
Rotatable Bond Count: 4  
XLogP3: 1.7  

 

 

Upstream Synthesis Route 
  • The 1-tert-Butyl 4-methyl 4-fluoropiperidine-1,4-dicarboxylate, known for its unique chemical structure, plays a crucial role in chemical synthesis processes. This compound serves as a versatile building block in the creation of various complex molecules due to its specific reactivity and functional groups. By acting as a key intermediate, it enables the formation of intricate organic compounds through diverse synthetic routes. Its presence allows for the selective modification and manipulation of molecules, making it an essential component in the development of new materials, pharmaceuticals, and agrochemicals.
FEATURED PRODUCTS