AE10192
Availability | ||
---|---|---|
Typically In Stock |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE10192 |
Chemical Name: | ARBEKACIN SULPHATE |
CAS Number: | 104931-87-5 |
Molecular Formula: | C22H46N6O14S |
Molecular Weight: | 650.6974 |
MDL Number: | MFCD00896451 |
SMILES: | OS(=O)(=O)O.NCC[C@@H](C(=O)N[C@@H]1C[C@H](N)[C@H]([C@@H]([C@H]1O[C@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)N)O)O)O[C@H]1O[C@H](CN)CC[C@H]1N)O |
Arbekacin sulfate, a potent antibiotic belonging to the aminoglycoside class, finds application in chemical synthesis as a key reagent. Its high efficiency in inhibiting a broad spectrum of bacterial infections makes it a valuable tool in the development of novel drugs and pharmaceutical compounds. In the realm of chemical synthesis, Arbekacin sulfate serves as a versatile building block for the construction of specialized molecules with enhanced biological activity. Its unique structural features enable precise manipulation to create structurally diverse analogs with tailored properties and functions. This compound plays a crucial role in the synthesis of various pharmaceutical intermediates and bioactive compounds, paving the way for innovative drug discovery and development efforts. By harnessing the synthetic potential of Arbekacin sulfate, researchers can explore new avenues in medicinal chemistry and contribute to the advancement of therapeutic interventions against infectious diseases and other medical conditions.