logo
Home  > Chemistry  > Heterocyclic Building Blocks  > Indoles  > Methyl 1-Boc-6-amino-indole-2-carboxylate

AE31485

1049677-82-8 | Methyl 1-Boc-6-amino-indole-2-carboxylate

Packsize Purity Availability Price Discounted Price    Quantity
250mg 95% in stock $209.00 $147.00 -   +
1g 95% in stock $657.00 $460.00 -   +
5g 95% in stock $1,878.00 $1,315.00 -   +
10g 95% in stock $2,810.00 $1,967.00 -   +
25g 95% in stock $5,608.00 $3,925.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AE31485
Chemical Name: Methyl 1-Boc-6-amino-indole-2-carboxylate
CAS Number: 1049677-82-8
Molecular Formula: C15H18N2O4
Molecular Weight: 290.3144
MDL Number: MFCD11053692
SMILES: COC(=O)c1cc2c(n1C(=O)OC(C)(C)C)cc(cc2)N

 

Computed Properties
Complexity: 418  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 21  
Hydrogen Bond Acceptor Count: 5  
Hydrogen Bond Donor Count: 1  
Rotatable Bond Count: 4  
XLogP3: 2.8  

 

 

Upstream Synthesis Route
  • 1-tert-Butyl 2-methyl 6-amino-1H-indole-1,2-dicarboxylate, commonly referred to as $name$, is a versatile compound widely utilized in chemical synthesis. This compound plays a crucial role as a key building block in the creation of various organic molecules and pharmaceutical intermediates. Its unique structure and reactivity make it a valuable tool in the development of novel materials and compounds. Specifically, $name$ is frequently employed in the synthesis of complex heterocyclic compounds and drug-like molecules due to its ability to serve as a scaffold for further functionalization. Its presence in the chemical synthesis process allows for the introduction of specific functional groups and modifications, enabling the production of target molecules with tailored properties and biological activities. Overall, the strategic incorporation of 1-tert-Butyl 2-methyl 6-amino-1H-indole-1,2-dicarboxylate in chemical synthesis endeavors facilitates the efficient and controlled construction of diverse organic compounds with potential applications across various industries.
FEATURED PRODUCTS