logo
Home  > Chemistry  > Organic Building Blocks  > Nitroes  > 3-Bromo-4-methyl-5-nitro-2-pyridinone

AB64473

1049706-72-0 | 3-Bromo-4-methyl-5-nitro-2-pyridinone

Packsize Purity Availability Price Discounted Price    Quantity
1g 95% in stock $79.00 $55.00 -   +
5g 95% in stock $219.00 $153.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AB64473
Chemical Name: 3-Bromo-4-methyl-5-nitro-2-pyridinone
CAS Number: 1049706-72-0
Molecular Formula: C6H5BrN2O3
Molecular Weight: 233.0195
MDL Number: MFCD12828179
SMILES: [O-][N+](=O)c1c[nH]c(=O)c(c1C)Br

 

Computed Properties
Complexity: 313  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 12  
Hydrogen Bond Acceptor Count: 3  
Hydrogen Bond Donor Count: 1  
XLogP3: 0.6  

 

 

Upstream Synthesis Route
  • 3-Bromo-4-methyl-5-nitro-2-pyridinone is a versatile compound commonly utilized in chemical synthesis for its unique properties and reactivity. This compound serves as a valuable building block in the creation of various organic molecules with enhanced functionalities. In chemical synthesis, 3-Bromo-4-methyl-5-nitro-2-pyridinone acts as a key intermediate in the formation of heterocyclic compounds, pharmaceuticals, and agrochemicals. Through its ability to undergo diverse reactions, such as nucleophilic substitution and cyclization, this compound plays a crucial role in the development of new drug candidates, pesticides, and materials with specialized properties. Additionally, 3-Bromo-4-methyl-5-nitro-2-pyridinone serves as a vital tool in the modification of complex molecular structures, offering chemists a precise and efficient method for synthesizing advanced organic compounds with tailored properties and applications.
FEATURED PRODUCTS