AE08189
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
50mg | 98% | 2 weeks | $411.00 | $288.00 | - + | |
100mg | 98% | 2 weeks | $649.00 | $454.00 | - + | |
250mg | 98% | 2 weeks | $1,093.00 | $765.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE08189 |
Chemical Name: | PROPYLENE GLYCOL DIOLEATE |
CAS Number: | 105-62-4 |
Molecular Formula: | C39H72O4 |
Molecular Weight: | 604.9866 |
MDL Number: | MFCD00048978 |
SMILES: | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(OC(=O)CCCCCCC/C=C\CCCCCCCC)C |
Propylene glycol dioleate is a versatile compound that finds application in chemical synthesis, particularly as a reaction medium or solvent. Its unique properties, including low toxicity and high chemical stability, make it a preferred choice for various chemical reactions. With its ability to dissolve a wide range of organic and inorganic compounds, propylene glycol dioleate serves as an efficient reaction medium for both small-scale laboratory experiments and large-scale industrial processes. Its compatibility with a variety of reagents and catalysts further enhances its utility in chemical synthesis, allowing for the efficient production of a wide range of compounds. In addition, propylene glycol dioleate's environmentally friendly nature makes it a sustainable option for green chemistry practices. Its role in promoting reaction efficiency and yield has established it as a valuable component in the arsenal of synthetic chemists.