AB50173
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $15.00 | $10.00 | - + | |
5g | 98% | in stock | $16.00 | $11.00 | - + | |
25g | 98% | in stock | $19.00 | $13.00 | - + | |
100g | 98% | in stock | $28.00 | $19.00 | - + | |
500g | 98% | in stock | $68.00 | $48.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB50173 |
Chemical Name: | Dibutyl fumarate |
CAS Number: | 105-75-9 |
Molecular Formula: | C12H20O4 |
Molecular Weight: | 228.2848 |
MDL Number: | MFCD00065141 |
SMILES: | CCCCOC(=O)/C=C/C(=O)OCCCC |
Complexity: | 209 |
Covalently-Bonded Unit Count: | 1 |
Defined Bond Stereocenter Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 10 |
XLogP3: | 2.7 |
Journal of medicinal chemistry 19770401