AD69233
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | in stock | $12.00 | $9.00 | - + | |
250mg | 98% | in stock | $24.00 | $17.00 | - + | |
500mg | 98% | in stock | $47.00 | $33.00 | - + | |
1g | 98% | in stock | $77.00 | $54.00 | - + | |
5g | 98% | in stock | $281.00 | $197.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD69233 |
Chemical Name: | 6-Bromo-1H-indole-2-carbaldehyde |
CAS Number: | 105191-12-6 |
Molecular Formula: | C9H6BrNO |
Molecular Weight: | 224.054 |
MDL Number: | MFCD06738308 |
SMILES: | O=Cc1cc2c([nH]1)cc(cc2)Br |
Complexity: | 185 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 1 |
XLogP3: | 2.5 |
6-Bromo-1H-indole-2-carbaldehyde is a versatile chemical compound that finds significant utility in various chemical synthesis processes. It serves as a valuable building block in the field of organic chemistry, particularly in the creation of pharmaceuticals, agrochemicals, and functional materials.This compound is commonly used as a key intermediate in the synthesis of complex molecules due to its unique reactivity and structural features. Its ability to undergo various chemical reactions, such as nucleophilic substitution and condensation reactions, allows for the efficient formation of intricate molecular structures.In the pharmaceutical industry, 6-Bromo-1H-indole-2-carbaldehyde is utilized for the preparation of novel drug candidates and potent bioactive compounds. Its indole framework and bromo substituent provide opportunities for the introduction of specific functional groups that are crucial for enhancing the biological activity and pharmacological properties of the final products.Furthermore, in the realm of agrochemicals, this compound plays a vital role in the development of crop protection agents and pesticides. By incorporating 6-Bromo-1H-indole-2-carbaldehyde into the synthesis of pesticide molecules, researchers can tailor the chemical properties of these compounds to achieve targeted pest control and improved agricultural productivity.Moreover, the versatile nature of 6-Bromo-1H-indole-2-carbaldehyde enables its use in the creation of functional materials with diverse applications. From designing advanced polymers to producing specialty chemicals, this compound offers a wide range of possibilities for researchers and industry professionals seeking innovative solutions in material science.Overall, the application of 6-Bromo-1H-indole-2-carbaldehyde in chemical synthesis showcases its significant role as a fundamental building block for the development of valuable compounds across various sectors, making it a crucial ingredient in the advancement of modern chemistry.