logo
Home  > Oxo[5,10,15,20-tetra(4-pyridyl)porphyrinato]titanium(IV)

AB78029

105250-49-5 | Oxo[5,10,15,20-tetra(4-pyridyl)porphyrinato]titanium(IV)

Packsize Purity Availability Price Discounted Price    Quantity
100mg >90.0%(HPLC) in stock $669.00 $468.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AB78029
Chemical Name: Oxo[5,10,15,20-tetra(4-pyridyl)porphyrinato]titanium(IV)
CAS Number: 105250-49-5
Molecular Formula: C40H30N8OTi
Molecular Weight: 686.5862
MDL Number: MFCD00191476
SMILES: O=[Ti+2]123[n-]4c5ccc4C(=C4N2C(C(=c2[n-]1c(=C(C1N3C(=C5c3ccncc3)CC1)c1ccncc1)cc2)c1ccncc1)CC4)c1ccncc1

 

Upstream Synthesis Route 
  • $Name$ is a versatile chemical reagent known for its efficacy in catalyzing various chemical synthesis reactions. As a catalytic material, Oxo[5,10,15,20-tetra(4-pyridyl)porphyrinato]titanium(IV) plays a crucial role in promoting the formation of new chemical bonds and facilitating complex transformations in organic synthesis. Its unique structure and properties make it particularly well-suited for mediating key reactions in areas such as organic functionalization, C-H bond activation, and asymmetric catalysis. The use of Oxo[5,10,15,20-tetra(4-pyridyl)porphyrinato]titanium(IV) in chemical synthesis not only enhances reaction rates and yields but also enables the development of novel synthetic strategies with high selectivity and efficiency.
FEATURED PRODUCTS