AD46001
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
25mg | 1 week | $869.00 | $608.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD46001 |
Chemical Name: | Cis-2-[(1,3-dihydro-1,3-dioxo-2h-isoindol-2-yl)methyl]-n,n-diethyl-1-phenylcyclopropanecarboxamide |
CAS Number: | 105310-75-6 |
Molecular Formula: | C23H24N2O3 |
Molecular Weight: | 376.4483 |
MDL Number: | MFCD11111825 |
SMILES: | CCN(C(=O)[C@@]1(C[C@@H]1CN1C(=O)c2c(C1=O)cccc2)c1ccccc1)CC |
cis-2-((1,3-Dioxoisoindolin-2-yl)methyl)-N,N-diethyl-1-phenylcyclopropanecarboxamide, commonly known as $name$, is a versatile compound widely used in chemical synthesis. Its unique chemical structure allows for a diverse range of applications in organic chemistry. $name$ is commonly employed as a key building block in the synthesis of complex molecules due to its ability to participate in various chemical reactions. It serves as a valuable intermediate in the construction of pharmaceuticals, agrochemicals, and specialty chemicals. In chemical synthesis, $name$ acts as a crucial reagent for the formation of new carbon-carbon and carbon-nitrogen bonds. Its cyclopropane moiety imparts steric constraints, making it an ideal substrate for controlled ring-opening reactions. Additionally, the presence of the phenyl and isoindolin-2-one groups provides opportunities for further functionalization through selective modifications.Researchers and chemists utilize $name$ to introduce structural complexity and diversity into their target molecules. Its strategic placement in synthetic routes allows for the efficient construction of challenging molecular frameworks. This compound's versatility and reactivity make it a valuable tool for the synthesis of novel compounds with potential applications in various fields.