AE24621
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $30.00 | $21.00 | - + | |
250mg | 95% | in stock | $63.00 | $44.00 | - + | |
1g | 95% | in stock | $177.00 | $124.00 | - + | |
5g | 95% | in stock | $556.00 | $390.00 | - + | |
10g | 95% | in stock | $945.00 | $661.00 | - + | |
25g | 95% | in stock | $1,878.00 | $1,315.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE24621 |
Chemical Name: | 4-Morpholino-3-(trifluoromethyl)aniline |
CAS Number: | 105316-06-1 |
Molecular Formula: | C11H13F3N2O |
Molecular Weight: | 246.2289 |
MDL Number: | MFCD06090415 |
SMILES: | Nc1ccc(c(c1)C(F)(F)F)N1CCOCC1 |
Complexity: | 254 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 1 |
XLogP3: | 1.9 |
4-Morpholino-3-(trifluoromethyl)aniline is a versatile compound widely used in chemical synthesis for its unique properties and diverse applications. This compound serves as a valuable building block in the synthesis of pharmaceuticals, agrochemicals, and materials science. Its trifluoromethyl group enhances the compound's reactivity and stability, making it a valuable tool in organic chemistry.In chemical synthesis, 4-Morpholino-3-(trifluoromethyl)aniline can be utilized as a key intermediate in the construction of complex molecules. The presence of the morpholine ring confers desirable properties such as solubility and steric effects, making it an ideal scaffold for the modification of molecular structures. With its trifluoromethyl group, this compound introduces unique electronic properties that can influence the reactivity and selectivity of chemical reactions.Furthermore, 4-Morpholino-3-(trifluoromethyl)aniline can be employed in the development of novel bioactive compounds, as the combination of the morpholine and trifluoromethyl functionalities can affect the biological activity and pharmacokinetic profile of the final products. Additionally, the trifluoromethyl group can enhance the compound's metabolic stability, potentially leading to improved drug candidates with enhanced efficacy and reduced side effects.Overall, the application of 4-Morpholino-3-(trifluoromethyl)aniline in chemical synthesis offers a wide range of possibilities for the design and synthesis of diverse molecules with varied functionalities and properties. Its utility extends across multiple fields, making it a valuable asset for synthetic chemists seeking to innovate and create new materials and compounds.