logo
Home  > Cyclohexanecarboxylicacid, 1,3,4-trihydroxy-5-oxo-, (1R,3R,4S)-

AD68727

10534-44-8 | Cyclohexanecarboxylicacid, 1,3,4-trihydroxy-5-oxo-, (1R,3R,4S)-

Availability
Typically In Stock

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AD68727
Chemical Name: Cyclohexanecarboxylicacid, 1,3,4-trihydroxy-5-oxo-, (1R,3R,4S)-
CAS Number: 10534-44-8
Molecular Formula: C7H10O6
Molecular Weight: 190.1507
MDL Number: MFCD00021283
SMILES: O[C@@H]1C[C@@](O)(CC(=O)[C@H]1O)C(=O)O

 

Upstream Synthesis Route
  • 3-Dehydroquinic acid, also known as DHA, is a key intermediate compound in chemical synthesis with versatile applications in various industries. In organic chemistry, 3-Dehydroquinic acid plays a crucial role as a precursor in the synthesis of aromatic compounds, particularly in the production of aromatic amino acids such as tryptophan, tyrosine, and phenylalanine. Its unique structure and reactivity make it a valuable building block for creating complex organic molecules.Apart from its significance in the synthesis of amino acids, 3-Dehydroquinic acid is also utilized in the pharmaceutical industry for developing drugs and pharmaceuticals. By incorporating DHA into the molecular structure of pharmaceutical compounds, chemists can modify the properties and enhance the efficacy of drugs for targeted applications. Additionally, 3-Dehydroquinic acid is employed in the production of specialty chemicals, flavors, and fragrances, where its structural versatility allows for the creation of diverse compounds with specific functionalities.In the realm of chemical research and development, 3-Dehydroquinic acid serves as a valuable tool for designing and synthesizing novel compounds with desired properties. Its ability to undergo various chemical transformations and reactions makes it a versatile platform for creating customized molecules for specific applications in areas such as materials science, agrochemicals, and biotechnology. Overall, the importance of 3-Dehydroquinic acid in chemical synthesis lies in its role as a fundamental building block for generating complex organic molecules with diverse applications in different sectors of the chemical industry.
FEATURED PRODUCTS