AB60047
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $16.00 | $11.00 | - + | |
1g | 97% | in stock | $22.00 | $15.00 | - + | |
5g | 97% | in stock | $79.00 | $55.00 | - + | |
25g | 97% | in stock | $296.00 | $207.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB60047 |
Chemical Name: | 2,4,6-Triisopropylbenzenesulfonamide |
CAS Number: | 105536-22-9 |
Molecular Formula: | C15H25NO2S |
Molecular Weight: | 283.4295 |
MDL Number: | MFCD00051975 |
SMILES: | CC(c1cc(cc(c1S(=O)(=O)N)C(C)C)C(C)C)C |
2,4,6-Triisopropylbenzenesulfonamide, commonly known as $name$, serves as a versatile reagent in chemical synthesis. Its unique molecular structure makes it a valuable tool in organic reactions, particularly in the field of pharmaceuticals and fine chemicals manufacturing.One key application of $name$ is as a protecting group in organic synthesis. By selectively blocking certain reactive sites on molecules, it allows chemists to control the course of a chemical reaction and protect sensitive functional groups from undesired reactions. This enables the synthesis of complex molecules with multiple reactive sites in a stepwise fashion, leading to increased efficiency and higher yields.Another important use of 2,4,6-Triisopropylbenzenesulfonamide is as a catalyst or reagent in various transformations. Its sulfonamide group can participate in nucleophilic substitution, elimination, and other types of reactions, providing a versatile platform for the modification of organic molecules. This reagent has been employed in the synthesis of pharmaceutical intermediates, agrochemicals, and specialty chemicals due to its ability to facilitate key bond-forming processes.In summary, 2,4,6-Triisopropylbenzenesulfonamide plays a crucial role in modern chemical synthesis as a protecting group and versatile reagent. Its applications across various industries highlight its significance in enabling the development of novel compounds and materials.