AB78124
Availability | ||
---|---|---|
Typically In Stock |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB78124 |
Chemical Name: | Pentafluorophen(ol-d) |
CAS Number: | 105596-34-7 |
Molecular Formula: | C6DF5O |
Molecular Weight: | 185.0697 |
MDL Number: | MFCD00209775 |
SMILES: | O([2H])c1c(F)c(F)c(c(c1F)F)F |
Pentafluorophenol-d is a versatile chemical compound commonly utilized in chemical synthesis as a potent synthetic building block. Its unique structure and reactivity make it an invaluable tool for organic chemists seeking to introduce fluorine atoms into target molecules. Due to the presence of deuterium in its structure, this compound offers distinctive labeling capabilities, allowing for precise tracking and identification in complex reaction schemes. Pentafluorophenol-d is frequently employed in the formation of various pharmaceuticals, agrochemicals, and specialty materials, serving as a key intermediate in the synthesis of diverse organic compounds. With its exceptional properties and broad applicability, Pentafluorophenol-d continues to play a crucial role in advancing modern chemical synthesis methodologies.