AB50458
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $8.00 | $6.00 | - + | |
1g | 95% | in stock | $22.00 | $16.00 | - + | |
25g | 95% | in stock | $511.00 | $358.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB50458 |
Chemical Name: | Isoquinoline-5-sulphonyl chloride, HCl |
CAS Number: | 105627-79-0 |
Molecular Formula: | C9H7Cl2NO2S |
Molecular Weight: | 264.1284 |
MDL Number: | MFCD08272853 |
SMILES: | ClS(=O)(=O)c1cccc2c1ccnc2.Cl |
Complexity: | 298 |
Covalently-Bonded Unit Count: | 2 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 1 |
5-Isoquinolinesulfonylchloride, hydrochloride (1:1) serves as a versatile reagent in chemical synthesis due to its unique properties and functionality. This compound is commonly utilized in the formation of sulfonyl derivatives, which are essential intermediates in organic synthesis. By reacting with various nucleophiles, 5-Isoquinolinesulfonylchloride, hydrochloride (1:1) can facilitate the introduction of the sulfonyl group into diverse molecular structures. Additionally, this reagent is employed in the preparation of pharmaceutical compounds, agrochemicals, and materials with specific functionalities. Its compatibility with a wide range of reaction conditions makes it a valuable tool for synthetic chemists seeking to incorporate sulfonyl functionalities into their target molecules.