105752-04-3 | 4-Iodo-3-nitroaniline

Packsize	Purity	Availability	Price	Discounted Price
1g	96%	in stock	$10.00	$7.00
5g	96%	in stock	$40.00	$28.00
25g	96%	in stock	$140.00	$98.00

Description

• Catalog Number: AB67718
• Chemical Name: 4-Iodo-3-nitroaniline
• CAS Number: 105752-04-3
• Molecular Formula: C6H5IN2O2
• Molecular Weight: 264.0206
• MDL Number: MFCD08458843
• SMILES: Nc1ccc(c(c1)[N+](=O)[O-])I

Upstream Synthesis Route

4-Iodo-3-nitroaniline, also known by its chemical formula C6H5IN2O2, is a versatile compound widely used in organic synthesis. This compound plays a crucial role in the development of various chemicals and materials due to its unique properties and reactivity.In chemical synthesis, 4-Iodo-3-nitroaniline serves as a valuable building block for the preparation of a range of complex organic molecules. It is commonly employed as a synthetic intermediate in the production of pharmaceuticals, agrochemicals, and dyes. The presence of both the nitro and amino groups in its structure allows for diverse functional group transformations, making it a key component in the construction of more elaborate chemical structures.Moreover, the iodo group in 4-Iodo-3-nitroaniline lends itself to various cross-coupling reactions, enabling the introduction of additional substituents or functional groups. This versatility opens up avenues for the creation of novel compounds with tailored properties for specific applications in fields such as medicinal chemistry and materials science.Overall, 4-Iodo-3-nitroaniline plays a crucial role in chemical synthesis by providing a platform for the elaboration of molecular structures with enhanced functionality and diverse applications. Its strategic position as a key intermediate highlights its importance in the development of new chemical entities and materials with potential industrial and scientific significance.