AD45875
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
50mg | 95% | 1 week | $180.00 | $126.00 | - + | |
100mg | 95% | 1 week | $228.00 | $160.00 | - + | |
250mg | 95% | 1 week | $291.00 | $204.00 | - + | |
500mg | 95% | 1 week | $410.00 | $287.00 | - + | |
1g | 95% | 1 week | $504.00 | $353.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD45875 |
Chemical Name: | 4,6-Dimethoxy-1h-indole-2-carboxylic acid |
CAS Number: | 105776-11-2 |
Molecular Formula: | C11H11NO4 |
Molecular Weight: | 221.2093 |
MDL Number: | MFCD02664473 |
SMILES: | COc1cc(OC)cc2c1cc([nH]2)C(=O)O |
4,6-Dimethoxy-1H-indole-2-carboxylic acid is a versatile compound widely used in chemical synthesis processes. This compound plays a crucial role in the development of various pharmaceuticals, agrochemicals, and materials due to its unique properties and reactivity. In chemical synthesis, 4,6-Dimethoxy-1H-indole-2-carboxylic acid serves as a key building block for the creation of complex organic molecules through a series of reactions and transformations. It can be utilized as a precursor in the synthesis of indole derivatives, which are important intermediates in the production of bioactive compounds and functional materials. Additionally, this compound can participate in diverse synthetic pathways to introduce indole functional groups into target molecules, enabling the design and modification of specific chemical structures with desired properties. Through its strategic incorporation in synthetic schemes, 4,6-Dimethoxy-1H-indole-2-carboxylic acid facilitates the efficient construction of advanced chemical entities for various applications in the fields of pharmaceuticals, agrochemicals, and materials science.