AY26752
Availability | ||
---|---|---|
Typically In Stock |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AY26752 |
Chemical Name: | Benzenamine,4-[(4-amino-2,5-dichlorophenyl)methyl]-2,5-dichloro- |
CAS Number: | 10586-68-2 |
Molecular Formula: | C13H10Cl4N2 |
Molecular Weight: | 336.0439 |
SMILES: | Clc1cc(N)c(cc1Cc1cc(Cl)c(cc1Cl)N)Cl |
Benzenamine, 4-[(4-amino-2,5-dichlorophenyl)methyl]-2,5-dichloro-, is a versatile compound widely utilized in chemical synthesis due to its unique properties. This compound serves as a crucial building block in the creation of various pharmaceuticals, agrochemicals, and specialty chemicals. Its structural features make it an ideal intermediate in the synthesis of complex organic molecules.In chemical synthesis, Benzenamine, 4-[(4-amino-2,5-dichlorophenyl)methyl]-2,5-dichloro-, plays a key role as a precursor for the preparation of diverse compounds with applications in medicinal chemistry and materials science. Its functional groups enable it to participate in a range of reactions, including nucleophilic substitutions, aromatic substitutions, and various coupling reactions.The strategic placement of amino and dichlorophenyl groups in this compound allows for selective modifications that are essential for the synthesis of target molecules with specific properties. Researchers and chemists rely on Benzenamine, 4-[(4-amino-2,5-dichlorophenyl)methyl]-2,5-dichloro-, as a vital component in their synthetic routes to access biologically active compounds and innovative materials.