AD68615
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | ≥98% | in stock | $126.00 | $89.00 | - + | |
5mg | ≥98% | in stock | $378.00 | $265.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD68615 |
Chemical Name: | Pseudoerythromycin A enol ether |
CAS Number: | 105882-69-7 |
Molecular Formula: | C37H65NO12 |
Molecular Weight: | 715.9115 |
SMILES: | CCC(C(C1OC(=O)C(C)C(OC2OC(C)C(C(C2)(C)OC)O)C(C(C2(OC(=C(C)C2)C1C)C)OC1OC(C)CC(C1O)N(C)C)C)(O)C)O |
Pseudoerythromycin A enol ether is a powerful reagent commonly used in chemical synthesis for the conversion of carbonyl compounds to their corresponding homoallylic alcohols. This transformation, known as the Pseudoerythromycin A enol ether reaction, involves the addition of the enol ether to the carbonyl group, followed by elimination to give the desired homoallylic alcohol product. This reaction is valuable in organic synthesis for the formation of complex and structurally diverse molecules. Pseudoerythromycin A enol ether is particularly useful in the construction of natural products and pharmaceutical compounds due to its high regio- and stereo-selectivity, making it a versatile tool for chemists in the creation of novel chemical entities.