AD68611
Availability | ||
---|---|---|
Typically In Stock |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD68611 |
Chemical Name: | MANGANESE ACETYLMETHIONATE |
CAS Number: | 105883-50-9 |
Molecular Formula: | C3H4MnO7S2 |
Molecular Weight: | 271.1277 |
SMILES: | CC(=O)C(S(=O)(=O)[O-])S(=O)(=O)[O-].[Mn+2] |
MANGANESE ACETYLMETHIONATE is a versatile compound widely used in chemical synthesis due to its unique properties. In organic chemistry, it serves as a valuable precursor for the preparation of a variety of manganese-containing complexes. These complexes play crucial roles in catalytic processes, particularly in oxidation reactions and asymmetric synthesis.Furthermore, MANGANESE ACETYLMETHIONATE is a key reagent in the production of certain pharmaceutical compounds. Its ability to facilitate selective functional group transformations makes it a valuable tool for medicinal chemists in the design and development of new drugs. Additionally, this compound is utilized in the preparation of novel materials with specific magnetic and electronic properties, making it relevant in materials science research.Overall, MANGANESE ACETYLMETHIONATE is a versatile and essential compound in chemical synthesis, playing a pivotal role in various scientific disciplines including organic chemistry, medicinal chemistry, and materials science.