AB73450
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 98% | in stock | $11.00 | $8.00 | - + | |
25g | 98% | in stock | $21.00 | $15.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB73450 |
Chemical Name: | Ethyl (R)-(-)-mandelate |
CAS Number: | 10606-72-1 |
Molecular Formula: | C10H12O3 |
Molecular Weight: | 180.2005 |
MDL Number: | MFCD00064248 |
SMILES: | CCOC(=O)[C@@H](c1ccccc1)O |
Complexity: | 162 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 4 |
XLogP3: | 1.5 |
Ethyl (R)-(-)-Mandelate is a valuable chiral compound widely used in chemical synthesis for its unique properties. As a key building block in organic chemistry, it serves as a versatile precursor for the synthesis of various optically active compounds. Its application in asymmetric synthesis allows for the creation of enantiomerically pure molecules, essential in pharmaceuticals, agrochemicals, and materials science. By utilizing Ethyl (R)-(-)-Mandelate as a starting material, chemists can efficiently access complex structures with high stereoselectivity, enabling the creation of new and innovative compounds with tailored properties.