AD78826
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $249.00 | $175.00 | - + | |
1g | 98% | in stock | $712.00 | $498.00 | - + | |
5g | 98% | in stock | $2,344.00 | $1,641.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD78826 |
Chemical Name: | 5-Acetamido-2-methylphenylboronic acid |
CAS Number: | 1060661-55-3 |
Molecular Formula: | C9H12BNO3 |
Molecular Weight: | 193.0075 |
MDL Number: | MFCD11053867 |
SMILES: | CC(=O)Nc1ccc(c(c1)B(O)O)C |
Complexity: | 210 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 2 |
(5-Acetamido-2-methylphenyl)boronic acid is a versatile organic compound widely utilized in chemical synthesis. It serves as a valuable building block in the preparation of various pharmaceuticals, agrochemicals, and materials due to its unique reactivity and functional group compatibility. One of its key applications lies in Suzuki-Miyaura cross-coupling reactions, where it acts as a boronic acid equivalent to facilitate the formation of carbon-carbon bonds. This compound's high stability and ease of manipulation make it a preferred reagent in drug discovery and complex molecule synthesis. Furthermore, it has found utility in the construction of heterocyclic systems and the modification of natural products, demonstrating its significance in modern synthetic chemistry.