logo
Home  > adenosine 5'-tetraphosphate

AE29724

1062-98-2 | adenosine 5'-tetraphosphate

Availability
Typically In Stock

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AE29724
Chemical Name: adenosine 5'-tetraphosphate
CAS Number: 1062-98-2
Molecular Formula: C10H17N5O16P4
Molecular Weight: 587.1609
MDL Number: MFCD00047245
SMILES: O[C@@H]1[C@@H](COP(=O)(OP(=O)(OP(=O)(OP(=O)(O)O)O)O)O)O[C@H]([C@@H]1O)n1cnc2c1ncnc2N

 

Upstream Synthesis Route 
  • Adenosine 5′-(pentahydrogen tetraphosphate) is a versatile compound widely used in chemical synthesis for its ability to provide high-energy phosphate bonds essential for various biochemical reactions. This molecule serves as a crucial cofactor in the synthesis of nucleic acids and is involved in energy metabolism processes within cells. Additionally, Adenosine 5′-(pentahydrogen tetraphosphate) plays a significant role in the regulation of enzyme activity and signal transduction pathways. Its applications range from the preparation of nucleotide analogs to the study of enzyme kinetics and inhibition mechanisms. In chemical synthesis, this compound acts as a key building block for the construction of complex molecules and serves as a valuable tool for investigating fundamental biological processes at the molecular level.
FEATURED PRODUCTS