1062158-63-7 | 3-Mesityl-5,6,7,8-tetrahydro-4H-cyclohepta[d]thiazol-3-ium perchlorate

Availability
Typically In Stock

Description

• Catalog Number: BH86337
• Chemical Name: 3-Mesityl-5,6,7,8-tetrahydro-4H-cyclohepta[d]thiazol-3-ium perchlorate
• CAS Number: 1062158-63-7
• Molecular Formula: C17H22ClNO4S
• Molecular Weight: 371.8789
• SMILES: [O-][Cl](=O)(=O)=O.Cc1cc(C)c(c(c1)C)[n+]1csc2c1CCCCC2

Upstream Synthesis Route

3-Mesityl-5,6,7,8-tetrahydro-4H-cyclohepta[d]thiazol-3-ium perchlorate, a versatile compound, plays a crucial role in chemical synthesis as a catalyst for various reactions. Its unique molecular structure allows for efficient activation of certain substrates, enabling the formation of complex organic compounds in a controlled manner. In the realm of organic synthesis, this compound has been particularly valuable in facilitating key transformations such as carbon-carbon bond formation, cyclization reactions, and asymmetric catalysis. Its use as a catalyst in chemical synthesis has led to the development of novel synthetic methodologies and the rapid construction of structurally diverse molecules with high efficiency and selectivity. The application of 3-Mesityl-5,6,7,8-tetrahydro-4H-cyclohepta[d]thiazol-3-ium perchlorate in chemical synthesis represents a significant advancement in the field, offering chemists a powerful tool for designing and creating complex molecules with precision and control.